About N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide
N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide (PubChem CID 142375374) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide.
Molecular Properties
| Compound Name | N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide |
| PubChem CID | 142375374 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide |
| SMILES | CCCOC1=CCCC=C1N(C)C=O |
| InChI | InChI=1S/C11H17NO2/c1-3-8-14-11-7-5-4-6-10(11)12(2)9-13/h6-7,9H,3-5,8H2,1-2H3 |
| InChIKey | NYYVBMCDZNXNOP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide?
The IUPAC name of N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide (CID 142375374) is N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide.
What is the SMILES notation for N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide?
The canonical SMILES for N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide is CCCOC1=CCCC=C1N(C)C=O.
What is the InChIKey of N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide?
The InChIKey is NYYVBMCDZNXNOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-3-8-14-11-7-5-4-6-10(11)12(2)9-13/h6-7,9H,3-5,8H2,1-2H3.
What are the key properties of N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide?
N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide has a molecular weight of 195.26 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(6-propoxycyclohexa-1,5-dien-1-yl)formamide is sourced from PubChem (CID 142375374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).