C21H43NO — CID 142377264
1-(2,2-dimethylpropyl)-N-heptyl-2,2-dimethylcyclopropane-1-carboxamide;propane (PubChem CID 142377264) has the molecular formula C21H43NO and a molecular weight of 325.58 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-N-heptyl-2,2-dimethylcyclopropane-1-carboxamide;propane.
| Compound Name | 1-(2,2-dimethylpropyl)-N-heptyl-2,2-dimethylcyclopropane-1-carboxamide;propane |
|---|---|
| PubChem CID | 142377264 |
| Molecular Formula | C21H43NO |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 325.33 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-N-heptyl-2,2-dimethylcyclopropane-1-carboxamide;propane |
| SMILES | CCC.CCCCCCCNC(=O)C1(CC(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C18H35NO.C3H8/c1-7-8-9-10-11-12-19-15(20)18(13-16(2,3)4)14-17(18,5)6;1-3-2/h7-14H2,1-6H3,(H,19,20);3H2,1-2H3 |
| InChIKey | CVBURDLTEOQTHP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|