C24H27FN2O5 — CID 142378763
2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-yloxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropanal;methanol (PubChem CID 142378763) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-yloxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropanal;methanol.
| Compound Name | 2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-yloxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropanal;methanol |
|---|---|
| PubChem CID | 142378763 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-yloxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropanal;methanol |
| SMILES | CC(C)(C=O)OCc1cc(-c2cccc(OC3COC3)c2)n(-c2ccccc2F)n1.CO |
| InChI | InChI=1S/C23H23FN2O4.CH4O/c1-23(2,15-27)29-12-17-11-22(26(25-17)21-9-4-3-8-20(21)24)16-6-5-7-18(10-16)30-19-13-28-14-19;1-2/h3-11,15,19H,12-14H2,1-2H3;2H,1H3 |
| InChIKey | COIPUIKUXBGPIF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|