C24H27FN2O5 — CID 135136789
2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-ylmethoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol (PubChem CID 135136789) has the molecular formula C24H27FN2O5 and a molecular weight of 442.49 g/mol. Its IUPAC name is 2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-ylmethoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol.
| Compound Name | 2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-ylmethoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol |
|---|---|
| PubChem CID | 135136789 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 2-[[1-(2-fluorophenyl)-5-[3-(oxetan-3-ylmethoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol |
| SMILES | CC(C)(OCc1cc(-c2cccc(OCC3COC3)c2)n(-c2ccccc2F)n1)C(O)O |
| InChI | InChI=1S/C24H27FN2O5/c1-24(2,23(28)29)32-15-18-11-22(27(26-18)21-9-4-3-8-20(21)25)17-6-5-7-19(10-17)31-14-16-12-30-13-16/h3-11,16,23,28-29H,12-15H2,1-2H3 |
| InChIKey | QQFSRGBIQFYRJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|