C26H34N2O5 — CID 135136940
2-[[1-[(3-methoxyphenyl)methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol (PubChem CID 135136940) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 2-[[1-[(3-methoxyphenyl)methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol.
| Compound Name | 2-[[1-[(3-methoxyphenyl)methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol |
|---|---|
| PubChem CID | 135136940 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 2-[[1-[(3-methoxyphenyl)methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol |
| SMILES | COc1cccc(Cn2nc(COC(C)(C)C(O)O)cc2-c2cccc(OCC(C)C)c2)c1 |
| InChI | InChI=1S/C26H34N2O5/c1-18(2)16-32-23-11-7-9-20(13-23)24-14-21(17-33-26(3,4)25(29)30)27-28(24)15-19-8-6-10-22(12-19)31-5/h6-14,18,25,29-30H,15-17H2,1-5H3 |
| InChIKey | IOVNLYALCCXMJN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|