C24H29N3O3 — CID 134587008
methyl 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazole-3-carboxylate (PubChem CID 134587008) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is methyl 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazole-3-carboxylate.
| Compound Name | methyl 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 134587008 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | methyl 1-[[4-(dimethylamino)phenyl]methyl]-5-[3-(2-methylpropoxy)phenyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(OCC(C)C)c2)n(Cc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C24H29N3O3/c1-17(2)16-30-21-8-6-7-19(13-21)23-14-22(24(28)29-5)25-27(23)15-18-9-11-20(12-10-18)26(3)4/h6-14,17H,15-16H2,1-5H3 |
| InChIKey | SZPHHVUEXIQDBB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|