C22H22N2O4 — CID 134587090
methyl 1-[(2-cyclopropyloxyphenyl)methyl]-5-(3-methoxyphenyl)pyrazole-3-carboxylate (PubChem CID 134587090) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 1-[(2-cyclopropyloxyphenyl)methyl]-5-(3-methoxyphenyl)pyrazole-3-carboxylate.
| Compound Name | methyl 1-[(2-cyclopropyloxyphenyl)methyl]-5-(3-methoxyphenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 134587090 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 1-[(2-cyclopropyloxyphenyl)methyl]-5-(3-methoxyphenyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(OC)c2)n(Cc2ccccc2OC2CC2)n1 |
| InChI | InChI=1S/C22H22N2O4/c1-26-18-8-5-7-15(12-18)20-13-19(22(25)27-2)23-24(20)14-16-6-3-4-9-21(16)28-17-10-11-17/h3-9,12-13,17H,10-11,14H2,1-2H3 |
| InChIKey | GYTXVASRGRCGOX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |