C28H34N4O4Si — CID 140877303
methyl 5-(3-cyclopropyloxyphenyl)-1-[[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methyl]pyrazole-3-carboxylate (PubChem CID 140877303) has the molecular formula C28H34N4O4Si and a molecular weight of 518.69 g/mol. Its IUPAC name is methyl 5-(3-cyclopropyloxyphenyl)-1-[[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methyl]pyrazole-3-carboxylate.
| Compound Name | methyl 5-(3-cyclopropyloxyphenyl)-1-[[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 140877303 |
| Molecular Formula | C28H34N4O4Si |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | methyl 5-(3-cyclopropyloxyphenyl)-1-[[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]methyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(OC3CC3)c2)n(Cc2ccc3cnn(COCC[Si](C)(C)C)c3c2)n1 |
| InChI | InChI=1S/C28H34N4O4Si/c1-34-28(33)25-16-27(21-6-5-7-24(15-21)36-23-10-11-23)31(30-25)18-20-8-9-22-17-29-32(26(22)14-20)19-35-12-13-37(2,3)4/h5-9,14-17,23H,10-13,18-19H2,1-4H3 |
| InChIKey | JZDLRXFMIVMBSO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|