C25H30N4O2Si — CID 140931469
1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one (PubChem CID 140931469) has the molecular formula C25H30N4O2Si and a molecular weight of 446.63 g/mol. Its IUPAC name is 1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one.
| Compound Name | 1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one |
|---|---|
| PubChem CID | 140931469 |
| Molecular Formula | C25H30N4O2Si |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 1-[(3-aminophenyl)methyl]-5-[1-(2-trimethylsilylethoxymethyl)indazol-6-yl]pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCn1ncc2ccc(-c3ccc(=O)n(Cc4cccc(N)c4)c3)cc21 |
| InChI | InChI=1S/C25H30N4O2Si/c1-32(2,3)12-11-31-18-29-24-14-20(7-8-21(24)15-27-29)22-9-10-25(30)28(17-22)16-19-5-4-6-23(26)13-19/h4-10,13-15,17H,11-12,16,18,26H2,1-3H3 |
| InChIKey | QPLFLEVWDWMZEB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|