C28H32F2N4O3Si — CID 154628869
methyl 3-[5-[(1S)-1-amino-2-(3,5-difluorophenyl)ethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]benzoate (PubChem CID 154628869) has the molecular formula C28H32F2N4O3Si and a molecular weight of 538.67 g/mol. Its IUPAC name is methyl 3-[5-[(1S)-1-amino-2-(3,5-difluorophenyl)ethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]benzoate.
| Compound Name | methyl 3-[5-[(1S)-1-amino-2-(3,5-difluorophenyl)ethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]benzoate |
|---|---|
| PubChem CID | 154628869 |
| Molecular Formula | C28H32F2N4O3Si |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | methyl 3-[5-[(1S)-1-amino-2-(3,5-difluorophenyl)ethyl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-6-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cc3c(cnn3COCC[Si](C)(C)C)nc2[C@@H](N)Cc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C28H32F2N4O3Si/c1-36-28(35)20-7-5-6-19(13-20)23-15-26-25(16-32-34(26)17-37-8-9-38(2,3)4)33-27(23)24(31)12-18-10-21(29)14-22(30)11-18/h5-7,10-11,13-16,24H,8-9,12,17,31H2,1-4H3/t24-/m0/s1 |
| InChIKey | XUEFXYYLQNDZQO-DEOSSOPVSA-N |
| XLogP | 5.72 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|