C20H17N3O5 — CID 154024646
methyl 5-(3-cyclopropyloxyphenyl)-1-(2-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 154024646) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is methyl 5-(3-cyclopropyloxyphenyl)-1-(2-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | methyl 5-(3-cyclopropyloxyphenyl)-1-(2-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 154024646 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | methyl 5-(3-cyclopropyloxyphenyl)-1-(2-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2cccc(OC3CC3)c2)n(-c2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H17N3O5/c1-27-20(24)16-12-19(13-5-4-6-15(11-13)28-14-9-10-14)22(21-16)17-7-2-3-8-18(17)23(25)26/h2-8,11-12,14H,9-10H2,1H3 |
| InChIKey | FYFVQGJUAZONBP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|