C23H27ClN2O4 — CID 135136746
2-[[1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)-4-methylpyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol (PubChem CID 135136746) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is 2-[[1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)-4-methylpyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol.
| Compound Name | 2-[[1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)-4-methylpyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol |
|---|---|
| PubChem CID | 135136746 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | 2-[[1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)-4-methylpyrazol-3-yl]methoxy]-2-methylpropane-1,1-diol |
| SMILES | COc1cccc(-c2c(C)c(COC(C)(C)C(O)O)nn2Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H27ClN2O4/c1-15-20(14-30-23(2,3)22(27)28)25-26(13-17-8-5-6-11-19(17)24)21(15)16-9-7-10-18(12-16)29-4/h5-12,22,27-28H,13-14H2,1-4H3 |
| InChIKey | QXVQHVWIAJHTCR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|