C36H31ClN2OP+ — CID 134587065
[1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)pyrazol-3-yl]methyl-triphenylphosphanium (PubChem CID 134587065) has the molecular formula C36H31ClN2OP+ and a molecular weight of 574.08 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)pyrazol-3-yl]methyl-triphenylphosphanium.
| Compound Name | [1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)pyrazol-3-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 134587065 |
| Molecular Formula | C36H31ClN2OP+ |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]-5-(3-methoxyphenyl)pyrazol-3-yl]methyl-triphenylphosphanium |
| SMILES | COc1cccc(-c2cc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)nn2Cc2ccccc2Cl)c1 |
| InChI | InChI=1S/C36H31ClN2OP/c1-40-31-16-13-15-28(24-31)36-25-30(38-39(36)26-29-14-11-12-23-35(29)37)27-41(32-17-5-2-6-18-32,33-19-7-3-8-20-33)34-21-9-4-10-22-34/h2-25H,26-27H2,1H3/q+1 |
| InChIKey | UXEAEZYSPSOKGK-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|