C24H33F3N4O2S — CID 142378959
formamide;1-methylpiperidin-4-ol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline (PubChem CID 142378959) has the molecular formula C24H33F3N4O2S and a molecular weight of 498.62 g/mol. Its IUPAC name is formamide;1-methylpiperidin-4-ol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline.
| Compound Name | formamide;1-methylpiperidin-4-ol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 142378959 |
| Molecular Formula | C24H33F3N4O2S |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | formamide;1-methylpiperidin-4-ol;N-(4-pyrrolidin-1-ylsulfanylphenyl)-4-(trifluoromethyl)aniline |
| SMILES | CN1CCC(O)CC1.FC(F)(F)c1ccc(Nc2ccc(SN3CCCC3)cc2)cc1.NC=O |
| InChI | InChI=1S/C17H17F3N2S.C6H13NO.CH3NO/c18-17(19,20)13-3-5-14(6-4-13)21-15-7-9-16(10-8-15)23-22-11-1-2-12-22;1-7-4-2-6(8)3-5-7;2-1-3/h3-10,21H,1-2,11-12H2;6,8H,2-5H2,1H3;1H,(H2,2,3) |
| InChIKey | AUDWQIFFYHTLLH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|