C33H27NO — CID 142380719
3-(7,8-dihydrodibenzofuran-4-yl)-5-(9,9-dimethylfluoren-2-yl)aniline (PubChem CID 142380719) has the molecular formula C33H27NO and a molecular weight of 453.59 g/mol. Its IUPAC name is 3-(7,8-dihydrodibenzofuran-4-yl)-5-(9,9-dimethylfluoren-2-yl)aniline.
| Compound Name | 3-(7,8-dihydrodibenzofuran-4-yl)-5-(9,9-dimethylfluoren-2-yl)aniline |
|---|---|
| PubChem CID | 142380719 |
| Molecular Formula | C33H27NO |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 3-(7,8-dihydrodibenzofuran-4-yl)-5-(9,9-dimethylfluoren-2-yl)aniline |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc(N)cc(-c4cccc5c6c(oc45)=CCCC=6)c3)cc21 |
| InChI | InChI=1S/C33H27NO/c1-33(2)29-12-5-3-8-25(29)26-15-14-20(19-30(26)33)21-16-22(18-23(34)17-21)24-10-7-11-28-27-9-4-6-13-31(27)35-32(24)28/h3,5,7-19H,4,6,34H2,1-2H3 |
| InChIKey | YVLNBOOIODDGGC-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|