C34H28O — CID 156827136
6-[9,9-dimethyl-6-(4-methylphenyl)fluoren-2-yl]-2,3-dihydrodibenzofuran (PubChem CID 156827136) has the molecular formula C34H28O and a molecular weight of 452.60 g/mol. Its IUPAC name is 6-[9,9-dimethyl-6-(4-methylphenyl)fluoren-2-yl]-2,3-dihydrodibenzofuran.
| Compound Name | 6-[9,9-dimethyl-6-(4-methylphenyl)fluoren-2-yl]-2,3-dihydrodibenzofuran |
|---|---|
| PubChem CID | 156827136 |
| Molecular Formula | C34H28O |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 6-[9,9-dimethyl-6-(4-methylphenyl)fluoren-2-yl]-2,3-dihydrodibenzofuran |
| SMILES | Cc1ccc(-c2ccc3c(c2)-c2ccc(-c4cccc5c6c(oc45)=CCCC=6)cc2C3(C)C)cc1 |
| InChI | InChI=1S/C34H28O/c1-21-11-13-22(14-12-21)23-16-18-30-29(19-23)26-17-15-24(20-31(26)34(30,2)3)25-8-6-9-28-27-7-4-5-10-32(27)35-33(25)28/h6-20H,4-5H2,1-3H3 |
| InChIKey | BQCDVPXOYBPFIA-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |