C18H19ClN2O3 — CID 142381159
7-chloro-3-(3,5-dimethoxyphenyl)-2H-2,6-naphthyridin-1-one;ethane (PubChem CID 142381159) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 7-chloro-3-(3,5-dimethoxyphenyl)-2H-2,6-naphthyridin-1-one;ethane.
| Compound Name | 7-chloro-3-(3,5-dimethoxyphenyl)-2H-2,6-naphthyridin-1-one;ethane |
|---|---|
| PubChem CID | 142381159 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 7-chloro-3-(3,5-dimethoxyphenyl)-2H-2,6-naphthyridin-1-one;ethane |
| SMILES | CC.COc1cc(OC)cc(-c2cc3cnc(Cl)cc3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C16H13ClN2O3.C2H6/c1-21-11-3-9(4-12(6-11)22-2)14-5-10-8-18-15(17)7-13(10)16(20)19-14;1-2/h3-8H,1-2H3,(H,19,20);1-2H3 |
| InChIKey | BWFSALWGICPFSN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|