C22H24F5N5O3 — CID 142381218
6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidine-2,8-diamine;oxane (PubChem CID 142381218) has the molecular formula C22H24F5N5O3 and a molecular weight of 501.46 g/mol. Its IUPAC name is 6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidine-2,8-diamine;oxane.
| Compound Name | 6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidine-2,8-diamine;oxane |
|---|---|
| PubChem CID | 142381218 |
| Molecular Formula | C22H24F5N5O3 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | 6-(2,6-difluoro-3,5-dimethoxyphenyl)-8-N-(2,2,2-trifluoroethyl)pyrido[3,4-d]pyrimidine-2,8-diamine;oxane |
| SMILES | C1CCOCC1.COc1cc(OC)c(F)c(-c2cc3cnc(N)nc3c(NCC(F)(F)F)n2)c1F |
| InChI | InChI=1S/C17H14F5N5O2.C5H10O/c1-28-9-4-10(29-2)13(19)11(12(9)18)8-3-7-5-24-16(23)27-14(7)15(26-8)25-6-17(20,21)22;1-2-4-6-5-3-1/h3-5H,6H2,1-2H3,(H,25,26)(H2,23,24,27);1-5H2 |
| InChIKey | PLBJXJSOSPDYRX-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |