C18H13ClN6O4 — CID 1423819
N-[(7S)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-nitrobenzamide (PubChem CID 1423819) has the molecular formula C18H13ClN6O4 and a molecular weight of 412.79 g/mol. Its IUPAC name is N-[(7S)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-nitrobenzamide.
| Compound Name | N-[(7S)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 1423819 |
| Molecular Formula | C18H13ClN6O4 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[(7S)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-nitrobenzamide |
| SMILES | O=C1C[C@@H](c2ccc(Cl)cc2)n2nc(NC(=O)c3cccc([N+](=O)[O-])c3)nc2N1 |
| InChI | InChI=1S/C18H13ClN6O4/c19-12-6-4-10(5-7-12)14-9-15(26)20-18-22-17(23-24(14)18)21-16(27)11-2-1-3-13(8-11)25(28)29/h1-8,14H,9H2,(H2,20,21,22,23,26,27)/t14-/m0/s1 |
| InChIKey | RFCQFNLRBOXFHS-AWEZNQCLSA-N |
| XLogP | 3.02 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|