C11H16N2 — CID 142382036
3-ethenylimino-2,2,5-trimethylhex-4-enenitrile (PubChem CID 142382036) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-ethenylimino-2,2,5-trimethylhex-4-enenitrile.
| Compound Name | 3-ethenylimino-2,2,5-trimethylhex-4-enenitrile |
|---|---|
| PubChem CID | 142382036 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 3-ethenylimino-2,2,5-trimethylhex-4-enenitrile |
| SMILES | C=C/N=C(\C=C(C)C)C(C)(C)C#N |
| InChI | InChI=1S/C11H16N2/c1-6-13-10(7-9(2)3)11(4,5)8-12/h6-7H,1H2,2-5H3/b13-10+ |
| InChIKey | UJYMEJAIYDCWTQ-JLHYYAGUSA-N |
| XLogP | 3.09 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|