C28H32ClN7O — CID 142382236
N-[3-[(Z)-N-aminocarbamohydrazonoyl]-4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-1-(3-chlorophenyl)cyclopropane-1-carboxamide (PubChem CID 142382236) has the molecular formula C28H32ClN7O and a molecular weight of 518.07 g/mol. Its IUPAC name is N-[3-[(Z)-N-aminocarbamohydrazonoyl]-4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-1-(3-chlorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[3-[(Z)-N-aminocarbamohydrazonoyl]-4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-1-(3-chlorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 142382236 |
| Molecular Formula | C28H32ClN7O |
| Molecular Weight | 518.07 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[3-[(Z)-N-aminocarbamohydrazonoyl]-4-[4-(4-methylpiperazin-1-yl)phenyl]phenyl]-1-(3-chlorophenyl)cyclopropane-1-carboxamide |
| SMILES | CN1CCN(c2ccc(-c3ccc(NC(=O)C4(c5cccc(Cl)c5)CC4)cc3/C(=N/N)NN)cc2)CC1 |
| InChI | InChI=1S/C28H32ClN7O/c1-35-13-15-36(16-14-35)23-8-5-19(6-9-23)24-10-7-22(18-25(24)26(33-30)34-31)32-27(37)28(11-12-28)20-3-2-4-21(29)17-20/h2-10,17-18H,11-16,30-31H2,1H3,(H,32,37)(H,33,34) |
| InChIKey | ZMVHTIUAFNYFRD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.07 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|