C25H19F5N2O4 — CID 142382355
ethyl 2-(6-ethyl-3-pyridinyl)-3-fluoro-5-[[2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-oxoacetyl]amino]benzoate (PubChem CID 142382355) has the molecular formula C25H19F5N2O4 and a molecular weight of 506.43 g/mol. Its IUPAC name is ethyl 2-(6-ethyl-3-pyridinyl)-3-fluoro-5-[[2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-oxoacetyl]amino]benzoate.
| Compound Name | ethyl 2-(6-ethyl-3-pyridinyl)-3-fluoro-5-[[2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 142382355 |
| Molecular Formula | C25H19F5N2O4 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | ethyl 2-(6-ethyl-3-pyridinyl)-3-fluoro-5-[[2-[2-fluoro-4-(trifluoromethyl)phenyl]-2-oxoacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cc(NC(=O)C(=O)c2ccc(C(F)(F)F)cc2F)cc(F)c1-c1ccc(CC)nc1 |
| InChI | InChI=1S/C25H19F5N2O4/c1-3-15-7-5-13(12-31-15)21-18(24(35)36-4-2)10-16(11-20(21)27)32-23(34)22(33)17-8-6-14(9-19(17)26)25(28,29)30/h5-12H,3-4H2,1-2H3,(H,32,34) |
| InChIKey | FPDUZOQYTZAHQX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|