C67H65B2NO4 — CID 142382490
N,N-bis[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2',3'-bis(ethenyl)spiro[fluorene-9,1'-indene]-4-amine (PubChem CID 142382490) has the molecular formula C67H65B2NO4 and a molecular weight of 969.88 g/mol. Its IUPAC name is N,N-bis[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2',3'-bis(ethenyl)spiro[fluorene-9,1'-indene]-4-amine.
| Compound Name | N,N-bis[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2',3'-bis(ethenyl)spiro[fluorene-9,1'-indene]-4-amine |
|---|---|
| PubChem CID | 142382490 |
| Molecular Formula | C67H65B2NO4 |
| Molecular Weight | 969.88 g/mol |
| Exact Mass | 969.51 |
| IUPAC Name | N,N-bis[9,9-dimethyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]-2',3'-bis(ethenyl)spiro[fluorene-9,1'-indene]-4-amine |
| SMILES | C=CC1=C(C=C)C2(c3ccccc31)c1ccccc1-c1c(N(c3ccc4c(c3)C(C)(C)c3cc(B5OC(C)(C)C(C)(C)O5)ccc3-4)c3ccc4c(c3)C(C)(C)c3cc(B5OC(C)(C)C(C)(C)O5)ccc3-4)cccc12 |
| InChI | InChI=1S/C67H65B2NO4/c1-15-44-45-22-17-19-24-52(45)67(51(44)16-2)53-25-20-18-23-50(53)60-54(67)26-21-27-59(60)70(42-30-34-48-46-32-28-40(36-55(46)61(3,4)57(48)38-42)68-71-63(7,8)64(9,10)72-68)43-31-35-49-47-33-29-41(37-56(47)62(5,6)58(49)39-43)69-73-65(11,12)66(13,14)74-69/h15-39H,1-2H2,3-14H3 |
| InChIKey | PTHIUGKCOCFDLC-UHFFFAOYSA-N |
| XLogP | 14.82 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.88 |
| LogP ≤ 5 | 14.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|