C66H57ClN2 — CID 139541052
3-N-[1,2-bis(ethenyl)-3,3-dimethylinden-5-yl]-5-chloro-1-N,1-N,3-N-tris(9,9-dimethylfluoren-2-yl)benzene-1,3-diamine (PubChem CID 139541052) has the molecular formula C66H57ClN2 and a molecular weight of 913.65 g/mol. Its IUPAC name is 3-N-[1,2-bis(ethenyl)-3,3-dimethylinden-5-yl]-5-chloro-1-N,1-N,3-N-tris(9,9-dimethylfluoren-2-yl)benzene-1,3-diamine.
| Compound Name | 3-N-[1,2-bis(ethenyl)-3,3-dimethylinden-5-yl]-5-chloro-1-N,1-N,3-N-tris(9,9-dimethylfluoren-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 139541052 |
| Molecular Formula | C66H57ClN2 |
| Molecular Weight | 913.65 g/mol |
| Exact Mass | 912.42 |
| IUPAC Name | 3-N-[1,2-bis(ethenyl)-3,3-dimethylinden-5-yl]-5-chloro-1-N,1-N,3-N-tris(9,9-dimethylfluoren-2-yl)benzene-1,3-diamine |
| SMILES | C=CC1=C(C=C)C(C)(C)c2cc(N(c3cc(Cl)cc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccc5c(c4)C(C)(C)c4ccccc4-5)c3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc21 |
| InChI | InChI=1S/C66H57ClN2/c1-11-47-51-29-25-41(36-59(51)63(3,4)55(47)12-2)68(42-26-30-52-48-19-13-16-22-56(48)64(5,6)60(52)37-42)45-33-40(67)34-46(35-45)69(43-27-31-53-49-20-14-17-23-57(49)65(7,8)61(53)38-43)44-28-32-54-50-21-15-18-24-58(50)66(9,10)62(54)39-44/h11-39H,1-2H2,3-10H3 |
| InChIKey | BCNHZLREMJHPHY-UHFFFAOYSA-N |
| XLogP | 18.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.65 |
| LogP ≤ 5 | 18.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |