C12H23N — CID 142383031
(E)-1-cyclohexyl-N,N-dimethylbut-1-en-1-amine (PubChem CID 142383031) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (E)-1-cyclohexyl-N,N-dimethylbut-1-en-1-amine.
| Compound Name | (E)-1-cyclohexyl-N,N-dimethylbut-1-en-1-amine |
|---|---|
| PubChem CID | 142383031 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (E)-1-cyclohexyl-N,N-dimethylbut-1-en-1-amine |
| SMILES | CC/C=C(\C1CCCCC1)N(C)C |
| InChI | InChI=1S/C12H23N/c1-4-8-12(13(2)3)11-9-6-5-7-10-11/h8,11H,4-7,9-10H2,1-3H3/b12-8+ |
| InChIKey | ASVDPVQJUZMYTG-XYOKQWHBSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |