C17H11F2NO2S — CID 142384350
methyl 3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzoate (PubChem CID 142384350) has the molecular formula C17H11F2NO2S and a molecular weight of 331.34 g/mol. Its IUPAC name is methyl 3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzoate.
| Compound Name | methyl 3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 142384350 |
| Molecular Formula | C17H11F2NO2S |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | methyl 3-fluoro-2-[5-(4-fluorophenyl)-1,3-thiazol-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(F)c1-c1ncc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H11F2NO2S/c1-22-17(21)12-3-2-4-13(19)15(12)16-20-9-14(23-16)10-5-7-11(18)8-6-10/h2-9H,1H3 |
| InChIKey | LQKMMSZNKIWPSE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |