C43H37N — CID 142384982
3-[2-[(Z)-3-[10-ethenyl-9-[(Z)-prop-1-enyl]phenanthren-3-yl]prop-1-enyl]-3-methyl-1-phenyl-6,7-dihydroinden-1-yl]pyridine (PubChem CID 142384982) has the molecular formula C43H37N and a molecular weight of 567.78 g/mol. Its IUPAC name is 3-[2-[(Z)-3-[10-ethenyl-9-[(Z)-prop-1-enyl]phenanthren-3-yl]prop-1-enyl]-3-methyl-1-phenyl-6,7-dihydroinden-1-yl]pyridine.
| Compound Name | 3-[2-[(Z)-3-[10-ethenyl-9-[(Z)-prop-1-enyl]phenanthren-3-yl]prop-1-enyl]-3-methyl-1-phenyl-6,7-dihydroinden-1-yl]pyridine |
|---|---|
| PubChem CID | 142384982 |
| Molecular Formula | C43H37N |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | 3-[2-[(Z)-3-[10-ethenyl-9-[(Z)-prop-1-enyl]phenanthren-3-yl]prop-1-enyl]-3-methyl-1-phenyl-6,7-dihydroinden-1-yl]pyridine |
| SMILES | C=Cc1c(/C=C\C)c2ccccc2c2cc(C/C=C\C3=C(C)C4=C(CCC=C4)C3(c3ccccc3)c3cccnc3)ccc12 |
| InChI | InChI=1S/C43H37N/c1-4-15-36-34(5-2)39-26-25-31(28-40(39)38-22-10-9-21-37(36)38)16-13-24-41-30(3)35-20-11-12-23-42(35)43(41,32-17-7-6-8-18-32)33-19-14-27-44-29-33/h4-11,13-15,17-22,24-29H,2,12,16,23H2,1,3H3/b15-4-,24-13- |
| InChIKey | WRZPSAJHDOWMJW-OBPHADGYSA-N |
| XLogP | 11.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|