C41H34N4 — CID 142385245
(1E,3Z)-2-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-9-phenylfluoren-9-yl]penta-1,3-dien-1-amine (PubChem CID 142385245) has the molecular formula C41H34N4 and a molecular weight of 582.75 g/mol. Its IUPAC name is (1E,3Z)-2-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-9-phenylfluoren-9-yl]penta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-2-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-9-phenylfluoren-9-yl]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142385245 |
| Molecular Formula | C41H34N4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | (1E,3Z)-2-[4-[4,6-bis(4-methylphenyl)-1,3,5-triazin-2-yl]-9-phenylfluoren-9-yl]penta-1,3-dien-1-amine |
| SMILES | C/C=C\C(=C/N)C1(c2ccccc2)c2ccccc2-c2c(-c3nc(-c4ccc(C)cc4)nc(-c4ccc(C)cc4)n3)cccc21 |
| InChI | InChI=1S/C41H34N4/c1-4-11-32(26-42)41(31-12-6-5-7-13-31)35-16-9-8-14-33(35)37-34(15-10-17-36(37)41)40-44-38(29-22-18-27(2)19-23-29)43-39(45-40)30-24-20-28(3)21-25-30/h4-26H,42H2,1-3H3/b11-4-,32-26+ |
| InChIKey | GZWUTHSGVIRBLZ-FZJUWJFUSA-N |
| XLogP | 9.22 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|