C11H23N2O2- — CID 142385933
4-[2-(4-methylpiperazin-1-yl)ethoxy]butan-1-olate (PubChem CID 142385933) has the molecular formula C11H23N2O2- and a molecular weight of 215.32 g/mol. Its IUPAC name is 4-[2-(4-methylpiperazin-1-yl)ethoxy]butan-1-olate.
| Compound Name | 4-[2-(4-methylpiperazin-1-yl)ethoxy]butan-1-olate |
|---|---|
| PubChem CID | 142385933 |
| Molecular Formula | C11H23N2O2- |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.18 |
| IUPAC Name | 4-[2-(4-methylpiperazin-1-yl)ethoxy]butan-1-olate |
| SMILES | CN1CCN(CCOCCCC[O-])CC1 |
| InChI | InChI=1S/C11H23N2O2/c1-12-4-6-13(7-5-12)8-11-15-10-3-2-9-14/h2-11H2,1H3/q-1 |
| InChIKey | PQBCAYUZAMDKDB-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|