C13H29N3O3 — CID 171070563
methanamine;2-[3-[2-(4-methylpiperazin-1-yl)ethoxy]propoxy]acetaldehyde (PubChem CID 171070563) has the molecular formula C13H29N3O3 and a molecular weight of 275.39 g/mol. Its IUPAC name is methanamine;2-[3-[2-(4-methylpiperazin-1-yl)ethoxy]propoxy]acetaldehyde.
| Compound Name | methanamine;2-[3-[2-(4-methylpiperazin-1-yl)ethoxy]propoxy]acetaldehyde |
|---|---|
| PubChem CID | 171070563 |
| Molecular Formula | C13H29N3O3 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | methanamine;2-[3-[2-(4-methylpiperazin-1-yl)ethoxy]propoxy]acetaldehyde |
| SMILES | CN.CN1CCN(CCOCCCOCC=O)CC1 |
| InChI | InChI=1S/C12H24N2O3.CH5N/c1-13-3-5-14(6-4-13)7-11-16-9-2-10-17-12-8-15;1-2/h8H,2-7,9-12H2,1H3;2H2,1H3 |
| InChIKey | JRCPBCFAASORRJ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|