About methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde
methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde (PubChem CID 163291744) has the molecular formula C12H26N2O3
and a molecular weight of 246.35 g/mol. Its IUPAC name is methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde.
Molecular Properties
| Compound Name | methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde |
| PubChem CID | 163291744 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde |
| SMILES | CCCN1CCN(CCOCC=O)CC1.CO |
| InChI | InChI=1S/C11H22N2O2.CH4O/c1-2-3-12-4-6-13(7-5-12)8-10-15-11-9-14;1-2/h9H,2-8,10-11H2,1H3;2H,1H3 |
| InChIKey | MLAPFJSQNPKWGO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde?
The IUPAC name of methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde (CID 163291744) is methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde.
What is the SMILES notation for methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde?
The canonical SMILES for methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde is CCCN1CCN(CCOCC=O)CC1.CO.
What is the InChIKey of methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde?
The InChIKey is MLAPFJSQNPKWGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2.CH4O/c1-2-3-12-4-6-13(7-5-12)8-10-15-11-9-14;1-2/h9H,2-8,10-11H2,1H3;2H,1H3.
What are the key properties of methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde?
methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde has a molecular weight of 246.35 g/mol, XLogP of -0.16, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-[2-(4-propylpiperazin-1-yl)ethoxy]acetaldehyde is sourced from PubChem (CID 163291744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).