About N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine
N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine (PubChem CID 142386779) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine.
Molecular Properties
| Compound Name | N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine |
| PubChem CID | 142386779 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine |
| SMILES | C=C(CCC)/C(C)=N/C.C=NCc1cccc(CC)c1 |
| InChI | InChI=1S/C10H13N.C8H15N/c1-3-9-5-4-6-10(7-9)8-11-2;1-5-6-7(2)8(3)9-4/h4-7H,2-3,8H2,1H3;2,5-6H2,1,3-4H3/b;9-8+ |
| InChIKey | GXMQVTDEQFHGPL-RJDPJKJLSA-N |
| XLogP | 4.88 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine?
The IUPAC name of N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine (CID 142386779) is N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine.
What is the SMILES notation for N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine?
The canonical SMILES for N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine is C=C(CCC)/C(C)=N/C.C=NCc1cccc(CC)c1.
What is the InChIKey of N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine?
The InChIKey is GXMQVTDEQFHGPL-RJDPJKJLSA-N. The full InChI is InChI=1S/C10H13N.C8H15N/c1-3-9-5-4-6-10(7-9)8-11-2;1-5-6-7(2)8(3)9-4/h4-7H,2-3,8H2,1H3;2,5-6H2,1,3-4H3/b;9-8+.
What are the key properties of N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine?
N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine has a molecular weight of 272.44 g/mol, XLogP of 4.88, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-ethylphenyl)methyl]methanimine;N-methyl-3-methylidenehexan-2-imine is sourced from PubChem (CID 142386779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).