C11H18Cl2N2 — CID 142386841
N-(3,3-dichloro-2-methylidenebutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 142386841) has the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. Its IUPAC name is N-(3,3-dichloro-2-methylidenebutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(3,3-dichloro-2-methylidenebutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 142386841 |
| Molecular Formula | C11H18Cl2N2 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-(3,3-dichloro-2-methylidenebutyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C=C(CNC1=NCCCCC1)C(C)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl2N2/c1-9(11(2,12)13)8-15-10-6-4-3-5-7-14-10/h1,3-8H2,2H3,(H,14,15) |
| InChIKey | PKGDKLAJBBUMQI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|