C10H18N2 — CID 114616706
N-(2-methylprop-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 114616706) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-(2-methylprop-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-(2-methylprop-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 114616706 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-(2-methylprop-2-enyl)-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C=C(C)CNC1=NCCCCC1 |
| InChI | InChI=1S/C10H18N2/c1-9(2)8-12-10-6-4-3-5-7-11-10/h1,3-8H2,2H3,(H,11,12) |
| InChIKey | XHLAXWSBZCRZCL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|