About 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine
6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine (PubChem CID 22756056) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine.
Analyze 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine?
The IUPAC name of 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine (CID 22756056) is 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine.
What is the SMILES notation for 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine?
The canonical SMILES for 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine is C=C(C)C1=NCCC(CC)N1.
What is the InChIKey of 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine?
The InChIKey is PXQZBFJUHPEMKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-8-5-6-10-9(11-8)7(2)3/h8H,2,4-6H2,1,3H3,(H,10,11).
What are the key properties of 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine?
6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine has a molecular weight of 152.24 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-prop-1-en-2-yl-1,4,5,6-tetrahydropyrimidine is sourced from PubChem (CID 22756056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).