About 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide
2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide (PubChem CID 88832844) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide.
Molecular Properties
| Compound Name | 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide |
| PubChem CID | 88832844 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide |
| SMILES | C=C(C)/C(=N\C(C)C)NC(C)C |
| InChI | InChI=1S/C10H20N2/c1-7(2)10(11-8(3)4)12-9(5)6/h8-9H,1H2,2-6H3,(H,11,12) |
| InChIKey | ZPQJIRNBBIEEKV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide?
The IUPAC name of 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide (CID 88832844) is 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide.
What is the SMILES notation for 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide?
The canonical SMILES for 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide is C=C(C)/C(=N\C(C)C)NC(C)C.
What is the InChIKey of 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide?
The InChIKey is ZPQJIRNBBIEEKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-7(2)10(11-8(3)4)12-9(5)6/h8-9H,1H2,2-6H3,(H,11,12).
What are the key properties of 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide?
2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide has a molecular weight of 168.28 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N'-di(propan-2-yl)prop-2-enimidamide is sourced from PubChem (CID 88832844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).