About (E)-N-ethyl-N',2-dimethylbut-2-enimidamide
(E)-N-ethyl-N',2-dimethylbut-2-enimidamide (PubChem CID 118973189) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is (E)-N-ethyl-N',2-dimethylbut-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N-ethyl-N',2-dimethylbut-2-enimidamide |
| PubChem CID | 118973189 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (E)-N-ethyl-N',2-dimethylbut-2-enimidamide |
| SMILES | C/C=C(C)/C(=N/C)NCC |
| InChI | InChI=1S/C8H16N2/c1-5-7(3)8(9-4)10-6-2/h5H,6H2,1-4H3,(H,9,10)/b7-5+ |
| InChIKey | SAQYVZCZLODHID-FNORWQNLSA-N |
| XLogP | 1.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-ethyl-N',2-dimethylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-ethyl-N',2-dimethylbut-2-enimidamide?
The IUPAC name of (E)-N-ethyl-N',2-dimethylbut-2-enimidamide (CID 118973189) is (E)-N-ethyl-N',2-dimethylbut-2-enimidamide.
What is the SMILES notation for (E)-N-ethyl-N',2-dimethylbut-2-enimidamide?
The canonical SMILES for (E)-N-ethyl-N',2-dimethylbut-2-enimidamide is C/C=C(C)/C(=N/C)NCC.
What is the InChIKey of (E)-N-ethyl-N',2-dimethylbut-2-enimidamide?
The InChIKey is SAQYVZCZLODHID-FNORWQNLSA-N. The full InChI is InChI=1S/C8H16N2/c1-5-7(3)8(9-4)10-6-2/h5H,6H2,1-4H3,(H,9,10)/b7-5+.
What are the key properties of (E)-N-ethyl-N',2-dimethylbut-2-enimidamide?
(E)-N-ethyl-N',2-dimethylbut-2-enimidamide has a molecular weight of 140.23 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-ethyl-N',2-dimethylbut-2-enimidamide is sourced from PubChem (CID 118973189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).