C10H20N2 — CID 123271328
(E)-N-tert-butyl-N',2-dimethylbut-2-enimidamide (PubChem CID 123271328) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (E)-N-tert-butyl-N',2-dimethylbut-2-enimidamide.
| Compound Name | (E)-N-tert-butyl-N',2-dimethylbut-2-enimidamide |
|---|---|
| PubChem CID | 123271328 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (E)-N-tert-butyl-N',2-dimethylbut-2-enimidamide |
| SMILES | C/C=C(C)/C(=N\C)NC(C)(C)C |
| InChI | InChI=1S/C10H20N2/c1-7-8(2)9(11-6)12-10(3,4)5/h7H,1-6H3,(H,11,12)/b8-7+ |
| InChIKey | DQMFGTDPQUUUSX-BQYQJAHWSA-N |
| XLogP | 2.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|