C14H25N3 — CID 154502300
2-N,5-N-ditert-butyl-3,4-dimethylpyrrole-2,5-diimine (PubChem CID 154502300) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-N,5-N-ditert-butyl-3,4-dimethylpyrrole-2,5-diimine.
| Compound Name | 2-N,5-N-ditert-butyl-3,4-dimethylpyrrole-2,5-diimine |
|---|---|
| PubChem CID | 154502300 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 2-N,5-N-ditert-butyl-3,4-dimethylpyrrole-2,5-diimine |
| SMILES | CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C |
| InChI | InChI=1S/C14H25N3/c1-9-10(2)12(17-14(6,7)8)15-11(9)16-13(3,4)5/h1-8H3,(H,15,16,17) |
| InChIKey | BNAMRNDSPGFXCL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|