C10H18N2 — CID 106188444
N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 106188444) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 106188444 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-(3-methylbut-2-enyl)-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | CC(C)=CCNC1=NCCCC1 |
| InChI | InChI=1S/C10H18N2/c1-9(2)6-8-12-10-5-3-4-7-11-10/h6H,3-5,7-8H2,1-2H3,(H,11,12) |
| InChIKey | OXHSUCCNASQPHG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|