C34H34ClF2N3O2S — CID 142387623
3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoro-1-piperazin-1-ylpropan-1-one (PubChem CID 142387623) has the molecular formula C34H34ClF2N3O2S and a molecular weight of 622.18 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoro-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoro-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 142387623 |
| Molecular Formula | C34H34ClF2N3O2S |
| Molecular Weight | 622.18 g/mol |
| Exact Mass | 621.20 |
| IUPAC Name | 3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoro-1-piperazin-1-ylpropan-1-one |
| SMILES | O=C(C(NSc1ccc2cc(OC3CCCC3)ccc2c1)C(F)(F)c1ccc(-c2ccc(Cl)cc2)cc1)N1CCNCC1 |
| InChI | InChI=1S/C34H34ClF2N3O2S/c35-28-13-7-24(8-14-28)23-5-11-27(12-6-23)34(36,37)32(33(41)40-19-17-38-18-20-40)39-43-31-16-10-25-21-30(15-9-26(25)22-31)42-29-3-1-2-4-29/h5-16,21-22,29,32,38-39H,1-4,17-20H2 |
| InChIKey | AQMAKCHCYQLQGW-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.18 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|