C36H38ClF3N2O2S — CID 142387507
3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;3-fluoro-1-methylpiperidine (PubChem CID 142387507) has the molecular formula C36H38ClF3N2O2S and a molecular weight of 655.23 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;3-fluoro-1-methylpiperidine.
| Compound Name | 3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;3-fluoro-1-methylpiperidine |
|---|---|
| PubChem CID | 142387507 |
| Molecular Formula | C36H38ClF3N2O2S |
| Molecular Weight | 655.23 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | 3-[4-(4-chlorophenyl)phenyl]-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;3-fluoro-1-methylpiperidine |
| SMILES | CN1CCCC(F)C1.O=CC(NSc1ccc2cc(OC3CCCC3)ccc2c1)C(F)(F)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H26ClF2NO2S.C6H12FN/c31-25-13-7-21(8-14-25)20-5-11-24(12-6-20)30(32,33)29(19-35)34-37-28-16-10-22-17-27(15-9-23(22)18-28)36-26-3-1-2-4-26;1-8-4-2-3-6(7)5-8/h5-19,26,29,34H,1-4H2;6H,2-5H2,1H3 |
| InChIKey | UPXPQBMUAJQQEK-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.23 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|