C31H38ClF2N3O3S — CID 142387694
3-(4-chloro-3-methoxyphenyl)-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;1-methylpiperidin-4-amine (PubChem CID 142387694) has the molecular formula C31H38ClF2N3O3S and a molecular weight of 606.18 g/mol. Its IUPAC name is 3-(4-chloro-3-methoxyphenyl)-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;1-methylpiperidin-4-amine.
| Compound Name | 3-(4-chloro-3-methoxyphenyl)-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 142387694 |
| Molecular Formula | C31H38ClF2N3O3S |
| Molecular Weight | 606.18 g/mol |
| Exact Mass | 605.23 |
| IUPAC Name | 3-(4-chloro-3-methoxyphenyl)-2-[(6-cyclopentyloxynaphthalen-2-yl)sulfanylamino]-3,3-difluoropropanal;1-methylpiperidin-4-amine |
| SMILES | CN1CCC(N)CC1.COc1cc(C(F)(F)C(C=O)NSc2ccc3cc(OC4CCCC4)ccc3c2)ccc1Cl |
| InChI | InChI=1S/C25H24ClF2NO3S.C6H14N2/c1-31-23-14-18(8-11-22(23)26)25(27,28)24(15-30)29-33-21-10-7-16-12-20(9-6-17(16)13-21)32-19-4-2-3-5-19;1-8-4-2-6(7)3-5-8/h6-15,19,24,29H,2-5H2,1H3;6H,2-5,7H2,1H3 |
| InChIKey | OIMIPUCWHXVXDW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.18 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|