C34H43F2N3O2S — CID 142387513
2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoro-3-(4-phenylphenyl)propanal;1-methylpiperidin-4-amine (PubChem CID 142387513) has the molecular formula C34H43F2N3O2S and a molecular weight of 595.80 g/mol. Its IUPAC name is 2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoro-3-(4-phenylphenyl)propanal;1-methylpiperidin-4-amine.
| Compound Name | 2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoro-3-(4-phenylphenyl)propanal;1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 142387513 |
| Molecular Formula | C34H43F2N3O2S |
| Molecular Weight | 595.80 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoro-3-(4-phenylphenyl)propanal;1-methylpiperidin-4-amine |
| SMILES | CN1CCC(N)CC1.O=CC(NSc1ccc(OCC2CCCCC2)cc1)C(F)(F)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H29F2NO2S.C6H14N2/c29-28(30,24-13-11-23(12-14-24)22-9-5-2-6-10-22)27(19-32)31-34-26-17-15-25(16-18-26)33-20-21-7-3-1-4-8-21;1-8-4-2-6(7)3-5-8/h2,5-6,9-19,21,27,31H,1,3-4,7-8,20H2;6H,2-5,7H2,1H3 |
| InChIKey | OQQCUOVHICAJQF-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.80 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|