C28H28ClF2NO2S — CID 142387496
3-[3-(4-chlorophenyl)phenyl]-2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoropropanal (PubChem CID 142387496) has the molecular formula C28H28ClF2NO2S and a molecular weight of 516.05 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)phenyl]-2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoropropanal.
| Compound Name | 3-[3-(4-chlorophenyl)phenyl]-2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoropropanal |
|---|---|
| PubChem CID | 142387496 |
| Molecular Formula | C28H28ClF2NO2S |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 3-[3-(4-chlorophenyl)phenyl]-2-[[4-(cyclohexylmethoxy)phenyl]sulfanylamino]-3,3-difluoropropanal |
| SMILES | O=CC(NSc1ccc(OCC2CCCCC2)cc1)C(F)(F)c1cccc(-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C28H28ClF2NO2S/c29-24-11-9-21(10-12-24)22-7-4-8-23(17-22)28(30,31)27(18-33)32-35-26-15-13-25(14-16-26)34-19-20-5-2-1-3-6-20/h4,7-18,20,27,32H,1-3,5-6,19H2 |
| InChIKey | OGGKOZWOAMJOPZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|