C27H23F7O2 — CID 118362241
[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenoxy]methylcycloheptane (PubChem CID 118362241) has the molecular formula C27H23F7O2 and a molecular weight of 512.47 g/mol. Its IUPAC name is [4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenoxy]methylcycloheptane.
| Compound Name | [4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenoxy]methylcycloheptane |
|---|---|
| PubChem CID | 118362241 |
| Molecular Formula | C27H23F7O2 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | [4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenoxy]methylcycloheptane |
| SMILES | Fc1cc(OC(F)(F)c2c(F)cc(-c3ccc(OCC4CCCCCC4)cc3)cc2F)cc(F)c1F |
| InChI | InChI=1S/C27H23F7O2/c28-21-11-18(17-7-9-19(10-8-17)35-15-16-5-3-1-2-4-6-16)12-22(29)25(21)27(33,34)36-20-13-23(30)26(32)24(31)14-20/h7-14,16H,1-6,15H2 |
| InChIKey | NRJXWNBGDKEVLW-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|