About 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane
2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane (PubChem CID 142389432) has the molecular formula C13H25N3
and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 142389432 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane |
| SMILES | CCN1CCC(N2CC3(CNC3)C2)C[C@@H]1C |
| InChI | InChI=1S/C13H25N3/c1-3-15-5-4-12(6-11(15)2)16-9-13(10-16)7-14-8-13/h11-12,14H,3-10H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | SWJPKHCEVANDOI-PXYINDEMSA-N |
| XLogP | 0.76 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane?
The IUPAC name of 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane (CID 142389432) is 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane is CCN1CCC(N2CC3(CNC3)C2)C[C@@H]1C.
What is the InChIKey of 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane?
The InChIKey is SWJPKHCEVANDOI-PXYINDEMSA-N. The full InChI is InChI=1S/C13H25N3/c1-3-15-5-4-12(6-11(15)2)16-9-13(10-16)7-14-8-13/h11-12,14H,3-10H2,1-2H3/t11-,12?/m0/s1.
What are the key properties of 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane?
2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane has a molecular weight of 223.36 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-1-ethyl-2-methylpiperidin-4-yl]-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 142389432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).