About 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride
2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride (PubChem CID 167729280) has the molecular formula C9H18Cl2N2
and a molecular weight of 225.16 g/mol. Its IUPAC name is 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride.
Molecular Properties
| Compound Name | 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride |
| PubChem CID | 167729280 |
| Molecular Formula | C9H18Cl2N2 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride |
| SMILES | C1CC(N2CC3(CNC3)C2)C1.Cl.Cl |
| InChI | InChI=1S/C9H16N2.2ClH/c1-2-8(3-1)11-6-9(7-11)4-10-5-9;;/h8,10H,1-7H2;2*1H |
| InChIKey | DQLGXZBQHYVNND-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride?
The IUPAC name of 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride (CID 167729280) is 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride.
What is the SMILES notation for 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride?
The canonical SMILES for 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride is C1CC(N2CC3(CNC3)C2)C1.Cl.Cl.
What is the InChIKey of 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride?
The InChIKey is DQLGXZBQHYVNND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2.2ClH/c1-2-8(3-1)11-6-9(7-11)4-10-5-9;;/h8,10H,1-7H2;2*1H.
What are the key properties of 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride?
2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride has a molecular weight of 225.16 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-2,6-diazaspiro[3.3]heptane;dihydrochloride is sourced from PubChem (CID 167729280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).