About 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane
2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane (PubChem CID 171838746) has the molecular formula C12H19F2N
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane |
| PubChem CID | 171838746 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane |
| SMILES | FC1(F)CC2(CN(C3CCCCC3)C2)C1 |
| InChI | InChI=1S/C12H19F2N/c13-12(14)6-11(7-12)8-15(9-11)10-4-2-1-3-5-10/h10H,1-9H2 |
| InChIKey | KGCSCHKUPFVBCX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane?
The IUPAC name of 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane (CID 171838746) is 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane.
What is the SMILES notation for 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane?
The canonical SMILES for 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane is FC1(F)CC2(CN(C3CCCCC3)C2)C1.
What is the InChIKey of 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane?
The InChIKey is KGCSCHKUPFVBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N/c13-12(14)6-11(7-12)8-15(9-11)10-4-2-1-3-5-10/h10H,1-9H2.
What are the key properties of 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane?
2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane has a molecular weight of 215.29 g/mol, XLogP of 3.05, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-6,6-difluoro-2-azaspiro[3.3]heptane is sourced from PubChem (CID 171838746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).