C25H25NO5S — CID 14238949
[(3S,4S)-4-acetyloxy-5-oxo-1-(5-phenylpent-4-ynyl)-2-phenylsulfanylpyrrolidin-3-yl] acetate (PubChem CID 14238949) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is [(3S,4S)-4-acetyloxy-5-oxo-1-(5-phenylpent-4-ynyl)-2-phenylsulfanylpyrrolidin-3-yl] acetate.
| Compound Name | [(3S,4S)-4-acetyloxy-5-oxo-1-(5-phenylpent-4-ynyl)-2-phenylsulfanylpyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 14238949 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | [(3S,4S)-4-acetyloxy-5-oxo-1-(5-phenylpent-4-ynyl)-2-phenylsulfanylpyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)N(CCCC#Cc2ccccc2)C(Sc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H25NO5S/c1-18(27)30-22-23(31-19(2)28)25(32-21-15-9-4-10-16-21)26(24(22)29)17-11-5-8-14-20-12-6-3-7-13-20/h3-4,6-7,9-10,12-13,15-16,22-23,25H,5,11,17H2,1-2H3/t22-,23-,25?/m0/s1 |
| InChIKey | APZBOJJSUCTCNX-REQUTJCGSA-N |
| XLogP | 3.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|